EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H48NO7P |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 242.144 |
| Monoisotopic Mass (excl. R groups) | 242.04296 |
| SMILES | *C(=O)OC[C@@]([H])(O)COP(=O)(O)OCCN |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PE(20:2/0:0) (CHEBI:145283) is a lysophosphatidylethanolamine 20:2 (CHEBI:132558) |
| Incoming Relation(s) |
| PE(20:2(11Z,14Z)/0:0) (CHEBI:145284) is a PE(20:2/0:0) (CHEBI:145283) |
| Synonyms | Source |
|---|---|
| LPE 20:2/0:0 | SUBMITTER |
| LPE(20:2/0:0) | SUBMITTER |
| LysoPE 20:2/0:0 | SUBMITTER |
| LysoPE(20:2/0:0) | SUBMITTER |
| PE 20:2/0:0 | SUBMITTER |