EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H46NO7P |
| Net Charge | 0 |
| Average Mass | 479.595 |
| Monoisotopic Mass | 479.30119 |
| SMILES | [H][C@@](O)(COC(=O)CCCCCCCCC/C=C\CCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C23H46NO7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(26)29-20-22(25)21-31-32(27,28)30-19-18-24/h7-8,22,25H,2-6,9-21,24H2,1H3,(H,27,28)/b8-7-/t22-/m1/s1 |
| InChIKey | WAYKKNOEMJFLDI-KOIKXXGWSA-N |
| Roles Classification |
|---|
| Biological Roles: | Papio hamadryas metabolite Any mammalian metabolite produced during a metabolic reaction in Papio hamadryas. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PE(18:1(11Z)/0:0) (CHEBI:145278) is a PE(18:1/0:0) (CHEBI:136140) |
| Synonyms | Source |
|---|---|
| LysoPE(18:1(11Z)/0:0) | SUBMITTER |
| LPE(18:1(11Z)/0:0) | SUBMITTER |
| LysoPE 18:1(11Z)/0:0 | SUBMITTER |
| LPE 18:1(11Z)/0:0 | SUBMITTER |
| PE 18:1(11Z)/0:0 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011505 | HMDB |
| LMGP02050064 | LIPID MAPS |