EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:145276 - (3E)-pent-3-en-2-one
| Formula | C5H8O |
| Net Charge | 0 |
| Average Mass | 84.118 |
| Monoisotopic Mass | 84.05751 |
| SMILES | C/C=C/C(C)=O |
| InChI | InChI=1S/C5H8O/c1-3-4-5(2)6/h3-4H,1-2H3/b4-3+ |
| InChIKey | LABTWGUMFABVFG-ONEGZZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis (ncbitaxon:4442) | - | DOI (10.1016/j.foodres.2018.03.026 ) | |
| Gerbera jamesonii (ncbitaxon:13547) | - | PubMed (30255657) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3E)-pent-3-en-2-one (CHEBI:145276) has role flavouring agent (CHEBI:35617) |
| (3E)-pent-3-en-2-one (CHEBI:145276) has role plant metabolite (CHEBI:76924) |
| (3E)-pent-3-en-2-one (CHEBI:145276) is a methyl propenyl ketone (CHEBI:89540) |
| (3E)-pent-3-en-2-one (CHEBI:145276) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| (3E)-pent-3-en-2-one |
| Synonyms | Source |
|---|---|
| (3E)-penten-2-one | SUBMITTER |
| (E)-3-penten-2-one | ChEBI |
| (E)-pent-3-en-2-one | ChEBI |
| trans-3-penten-2-one | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (E)-pent-3-en-2-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMFA12000028 | LIPID MAPS |
| Citations |
|---|