EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O |
| Net Charge | 0 |
| Average Mass | 84.118 |
| Monoisotopic Mass | 84.05751 |
| SMILES | C/C=C/C(C)=O |
| InChI | InChI=1S/C5H8O/c1-3-4-5(2)6/h3-4H,1-2H3/b4-3+ |
| InChIKey | LABTWGUMFABVFG-ONEGZZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis (ncbitaxon:4442) | - | DOI (10.1016/j.foodres.2018.03.026 ) | |
| Gerbera jamesonii (ncbitaxon:13547) | - | PubMed (30255657) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3E)-pent-3-en-2-one (CHEBI:145276) has role flavouring agent (CHEBI:35617) |
| (3E)-pent-3-en-2-one (CHEBI:145276) has role plant metabolite (CHEBI:76924) |
| (3E)-pent-3-en-2-one (CHEBI:145276) is a methyl propenyl ketone (CHEBI:89540) |
| (3E)-pent-3-en-2-one (CHEBI:145276) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| (3E)-pent-3-en-2-one |
| Synonyms | Source |
|---|---|
| (3E)-penten-2-one | SUBMITTER |
| (E)-3-penten-2-one | ChEBI |
| (E)-pent-3-en-2-one | ChEBI |
| trans-3-penten-2-one | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (E)-pent-3-en-2-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMFA12000028 | LIPID MAPS |
| Citations |
|---|