EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:145256 |
| ChEBI Name | 6,7-dihydroxy-4-methylcoumarin |
| Stars | |
| Definition | A hydroxycoumarin that is 4-methylcuomarin which is substituted by hydroxy groups at positions 3 and 4. A hyaluronan synthesis inhibitor. It has also been used as a fluorescent sensor to monitor the consumption of a boronic acid in Suzuki coupling reactions; fluorescence is readily detectable by the naked eye using a standard 365 nm UV lamp. |
| Last Modified | 31 October 2019 |
| Submitter | Gareth Owen |
| Downloads |
| Formula | C10H8O4 |
| Net Charge | 0 |
| Average Mass | 192.170 |
| Monoisotopic Mass | 192.04226 |
| SMILES | Cc1cc(=O)oc2cc(O)c(O)cc12 |
| InChI | InChI=1S/C10H8O4/c1-5-2-10(13)14-9-4-8(12)7(11)3-6(5)9/h2-4,11-12H,1H3 |
| InChIKey | KVOJTUXGYQVLAJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | hyaluronan synthesis inhibitor Any inhibitor that interferes with the synthesis of hyaluronic acid (HA, also known as hyaluronan). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,7-dihydroxy-4-methylcoumarin (CHEBI:145256) has role anti-inflammatory agent (CHEBI:67079) |
| 6,7-dihydroxy-4-methylcoumarin (CHEBI:145256) has role antioxidant (CHEBI:22586) |
| 6,7-dihydroxy-4-methylcoumarin (CHEBI:145256) has role hyaluronan synthesis inhibitor (CHEBI:145253) |
| 6,7-dihydroxy-4-methylcoumarin (CHEBI:145256) is a hydroxycoumarin (CHEBI:37912) |
| IUPAC Name |
|---|
| 6,7-dihydroxy-4-methyl-2H-chromen-2-one |
| Synonyms | Source |
|---|---|
| 4-methyl-6,7-dihydroxycoumarin | ChemIDplus |
| 4-methylaesculetin | ChemIDplus |
| 4-methylesculetin | ChemIDplus |
| 4-methylesculetol | ChemIDplus |
| 6,7-dihydroxy-4-methyl-2H-1-benzopyran-2-one | ChemIDplus |
| 6,7-dihydroxy-4-methyl-2H-benzopyran-2-one | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:529-84-0 | ChemIDplus |
| Citations |
|---|