EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H46NO7P |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 242.144 |
| Monoisotopic Mass (excl. R groups) | 242.04296 |
| SMILES | *C(=O)O[C@]([H])(CO)COP(=O)(O)OCCN |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PE(0:0/18:1) (CHEBI:145252) is a lysophosphatidylethanolamine 18:1 (CHEBI:64575) |
| Incoming Relation(s) |
| PE(0:0/18:1(11Z)) (CHEBI:145254) is a PE(0:0/18:1) (CHEBI:145252) |
| Synonyms | Source |
|---|---|
| LPE 0:0/18:1 | SUBMITTER |
| LPE(0:0/18:1) | SUBMITTER |
| LysoPE 0:0/18:1 | SUBMITTER |
| LysoPE(0:0/18:1) | SUBMITTER |
| PE 0:0/18:1 | SUBMITTER |