EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17NO2 |
| Net Charge | 0 |
| Average Mass | 159.229 |
| Monoisotopic Mass | 159.12593 |
| SMILES | CC(CCC(=O)[O-])[N+](C)(C)C |
| InChI | InChI=1S/C8H17NO2/c1-7(9(2,3)4)5-6-8(10)11/h7H,5-6H2,1-4H3 |
| InChIKey | RXHVPPWXTMHWGY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-aminovaleric acid betaine (CHEBI:145241) is a methyl-branched fatty acid (CHEBI:62499) |