EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2O7 |
| Net Charge | 0 |
| Average Mass | 288.256 |
| Monoisotopic Mass | 288.09575 |
| SMILES | CC[C@H](NC(=O)CCC(=O)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C11H16N2O7/c1-2-6(10(18)12-5-9(16)17)13-8(15)4-3-7(14)11(19)20/h6H,2-5H2,1H3,(H,12,18)(H,13,15)(H,16,17)(H,19,20)/t6-/m0/s1 |
| InChIKey | RRBLCHIJUKCUNR-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(4-carboxy-4-oxobutanoyl)-L-ethylglycylglycine (CHEBI:145231) is a dipeptide (CHEBI:46761) |
| N-(4-carboxy-4-oxobutanoyl)-L-ethylglycylglycine (CHEBI:145231) is a oxo dicarboxylic acid (CHEBI:36145) |
| N-(4-carboxy-4-oxobutanoyl)-L-ethylglycylglycine (CHEBI:145231) is a secondary carboxamide (CHEBI:140325) |
| N-(4-carboxy-4-oxobutanoyl)-L-ethylglycylglycine (CHEBI:145231) is conjugate acid of N-(4-carboxy-4-oxobutanoyl)-L-ethylglycylglycine(2−) (CHEBI:144697) |
| Incoming Relation(s) |
| N-(4-carboxy-4-oxobutanoyl)-L-ethylglycylglycine(2−) (CHEBI:144697) is conjugate base of N-(4-carboxy-4-oxobutanoyl)-L-ethylglycylglycine (CHEBI:145231) |
| IUPAC Name |
|---|
| 5-({(2S)-1-[(carboxymethyl)amino]-1-oxobutan-2-yl}amino)-2,5-dioxopentanoic acid |
| Synonyms | Source |
|---|---|
| CLONE_N-(4-carboxy-4-oxobutanoyl)-L-ethylglycylglycine | ChEBI |
| N-[(2S)-2-(4-carboxy-4-oxobutanoylamino)butanoyl]glycine | ChEBI |
| Citations |
|---|