EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H44O3 |
| Net Charge | 0 |
| Average Mass | 440.668 |
| Monoisotopic Mass | 440.32905 |
| SMILES | C/C(=C/CC/C(C)=C/CC/C(C)=C\CC[C@]1(C)CCc2c(C)c(O)c(C)c(C)c2O1)CO |
| InChI | InChI=1S/C29H44O3/c1-20(13-9-14-22(3)19-30)11-8-12-21(2)15-10-17-29(7)18-16-26-25(6)27(31)23(4)24(5)28(26)32-29/h11,14-15,30-31H,8-10,12-13,16-19H2,1-7H3/b20-11+,21-15-,22-14-/t29-/m1/s1 |
| InChIKey | OQCXIVSCFNNFEE-QFLITSPGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13'-hydroxy-alpha-tocotrienol (CHEBI:145208) is a tocotrienol (CHEBI:33235) |
| Manual Xrefs | Databases |
|---|---|
| HMDB0012560 | HMDB |