EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H80O19 |
| Net Charge | 0 |
| Average Mass | 949.138 |
| Monoisotopic Mass | 948.52938 |
| SMILES | [H][C@@]12CC=C3C(C)(C)[C@@H](O[C@@H]4O[C@H](CO[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O[C@@H]5OC[C@@H](O)[C@H](O)[C@@H]5O)[C@H]4O)CC[C@@]3([H])[C@]1(C)CC[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)[C@H](O)[C@@H](O)[C@@H](O)C(C)(C)O |
| InChI | InChI=1S/C47H80O19/c1-20(29(50)34(55)39(59)44(4,5)60)21-13-14-47(8)27-11-9-22-23(45(27,6)15-16-46(21,47)7)10-12-28(43(22,2)3)65-42-37(58)38(66-41-35(56)30(51)24(49)18-61-41)32(53)26(64-42)19-62-40-36(57)33(54)31(52)25(17-48)63-40/h9,20-21,23-42,48-60H,10-19H2,1-8H3/t20-,21+,23+,24+,25+,26+,27+,28-,29-,30-,31+,32+,33-,34+,35-,36+,37+,38-,39+,40+,41-,42-,45-,46+,47-/m0/s1 |
| InChIKey | VBPXCWKMJJPMSZ-PURPTQTASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Momordica charantia (ncbitaxon:3673) | seed (BTO:0001226) | MetaboLights (MTBLS701) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| momordicoside B (CHEBI:145190) is a 3-hydroxy steroid (CHEBI:36834) |
| momordicoside B (CHEBI:145190) is a polysaccharide derivative (CHEBI:65212) |
| momordicoside B (CHEBI:145190) is a steroid saponin (CHEBI:61655) |