EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H82O20 |
| Net Charge | 0 |
| Average Mass | 979.164 |
| Monoisotopic Mass | 978.53995 |
| SMILES | [H][C@@]12CC=C3C(C)(C)[C@@H](O[C@@H]4O[C@H](CO[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O)CC[C@@]3([H])[C@]1(C)CC[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)[C@H](O)[C@@H](O)[C@@H](O)C(C)(C)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C48H82O20/c1-20(29(51)36(58)40(62)45(4,5)68-43-39(61)34(56)31(53)25(18-50)65-43)21-13-14-48(8)27-11-9-22-23(46(27,6)15-16-47(21,48)7)10-12-28(44(22,2)3)67-42-38(60)35(57)32(54)26(66-42)19-63-41-37(59)33(55)30(52)24(17-49)64-41/h9,20-21,23-43,49-62H,10-19H2,1-8H3/t20-,21+,23+,24+,25+,26+,27+,28-,29-,30+,31+,32+,33-,34-,35-,36+,37+,38+,39+,40+,41+,42-,43-,46-,47+,48-/m0/s1 |
| InChIKey | FLOZMFUXKAHVBX-JCXXTIGUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Momordica charantia (ncbitaxon:3673) | seed (BTO:0001226) | MetaboLights (MTBLS701) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| momordicoside S (CHEBI:145177) is a 3-hydroxy steroid (CHEBI:36834) |
| momordicoside S (CHEBI:145177) is a disaccharide derivative (CHEBI:63353) |
| momordicoside S (CHEBI:145177) is a steroid saponin (CHEBI:61655) |