EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6D3N2O |
| Net Charge | +1 |
| Average Mass | 140.180 |
| Monoisotopic Mass | 140.08977 |
| SMILES | [2H]C([2H])([2H])[n+]1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C7H8N2O/c1-9-4-2-3-6(5-9)7(8)10/h2-5H,1H3,(H-,8,10)/p+1/i1D3 |
| InChIKey | LDHMAVIPBRSVRG-FIBGUPNXSA-O |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methyl nicotinamide-d3 (CHEBI:145117) is a 1-methylnicotinamide (CHEBI:16797) |
| 1-methyl nicotinamide-d3 (CHEBI:145117) is a deuterated compound (CHEBI:76107) |