EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:145117 - 1-methyl nicotinamide-d3
| Formula | C7H6D3N2O |
| Net Charge | +1 |
| Average Mass | 140.180 |
| Monoisotopic Mass | 140.08977 |
| SMILES | [2H]C([2H])([2H])[n+]1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C7H8N2O/c1-9-4-2-3-6(5-9)7(8)10/h2-5H,1H3,(H-,8,10)/p+1/i1D3 |
| InChIKey | LDHMAVIPBRSVRG-FIBGUPNXSA-O |
| Roles Classification |
|---|
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methyl nicotinamide-d3 (CHEBI:145117) is a 1-methylnicotinamide (CHEBI:16797) |
| 1-methyl nicotinamide-d3 (CHEBI:145117) is a deuterated compound (CHEBI:76107) |