EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O4 |
| Net Charge | 0 |
| Average Mass | 154.121 |
| Monoisotopic Mass | 154.02661 |
| SMILES | O=C1C=C2COC(O)C=C2O1 |
| InChI | InChI=1S/C7H6O4/c8-6-2-5-4(3-10-6)1-7(9)11-5/h1-2,6,8H,3H2 |
| InChIKey | ZGBMSNKHUHZKEP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | mycotoxin Poisonous substance produced by fungi. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isopatulin (CHEBI:145111) has role Penicillium metabolite (CHEBI:76964) |
| isopatulin (CHEBI:145111) has role antibacterial agent (CHEBI:33282) |
| isopatulin (CHEBI:145111) has role mycotoxin (CHEBI:25442) |
| isopatulin (CHEBI:145111) is a furopyran (CHEBI:74927) |
| isopatulin (CHEBI:145111) is a lactol (CHEBI:38131) |
| isopatulin (CHEBI:145111) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 6-hydroxy-4H-furo[3,2-c]pyran-2(6H)-one |
| Synonyms | Source |
|---|---|
| 3-hydroxy-4,9-dioxabicyclo[4.3.0]nona-1,6-dien-8-one | ChEBI |
| neopatulin | ChEBI |
| UniProt Name | Source |
|---|---|
| neopatulin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-16725 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:70402-10-7 | PubChem Compound |
| Citations |
|---|