EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36O6 |
| Net Charge | 0 |
| Average Mass | 384.513 |
| Monoisotopic Mass | 384.25119 |
| SMILES | [H][C@]12[C@H](C)C[C@@](C)(O)C[C@]1([H])C(=O)[C@@](C)(O)[C@H]([C@@H](CC)CO)[C@]2(C)C(=O)CCO |
| InChI | InChI=1S/C21H36O6/c1-6-13(11-23)17-20(4,15(24)7-8-22)16-12(2)9-19(3,26)10-14(16)18(25)21(17,5)27/h12-14,16-17,22-23,26-27H,6-11H2,1-5H3/t12-,13+,14+,16+,17-,19-,20-,21+/m1/s1 |
| InChIKey | UUOFDWJUPVQCFZ-BSXWIJKXSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrostemphyloxin I (CHEBI:145071) has functional parent stemphyloxin I (CHEBI:145070) |
| dihydrostemphyloxin I (CHEBI:145071) has role fungal metabolite (CHEBI:76946) |
| dihydrostemphyloxin I (CHEBI:145071) is a cyclic ketone (CHEBI:3992) |
| dihydrostemphyloxin I (CHEBI:145071) is a diketone (CHEBI:46640) |
| dihydrostemphyloxin I (CHEBI:145071) is a octahydronaphthalenes (CHEBI:138397) |
| dihydrostemphyloxin I (CHEBI:145071) is a primary alcohol (CHEBI:15734) |
| dihydrostemphyloxin I (CHEBI:145071) is a tertiary alcohol (CHEBI:26878) |
| dihydrostemphyloxin I (CHEBI:145071) is a tetrol (CHEBI:33573) |
| dihydrostemphyloxin I (CHEBI:145071) is a α-hydroxy ketone (CHEBI:139588) |
| dihydrostemphyloxin I (CHEBI:145071) is a β-hydroxy ketone (CHEBI:55380) |
| IUPAC Name |
|---|
| (2S,3R,4R,4aS,5R,7R,8aS)-2,7-dihydroxy-3-[(2R)-1-hydroxybutan-2-yl]-4-(3-hydroxypropanoyl)-2,4,5,7-tetramethyloctahydronaphthalen-1(2H)-one |
| Citations |
|---|