EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34O6 |
| Net Charge | 0 |
| Average Mass | 382.497 |
| Monoisotopic Mass | 382.23554 |
| SMILES | [H][C@]12C[C@](C)(O)C[C@@]([H])(C)[C@]1([H])[C@@]1(C)C(=O)/C(=C\O)[C@]2(O)[C@@](C)(O)[C@]1([H])[C@@H](CC)CO |
| InChI | InChI=1S/C21H34O6/c1-6-12(9-22)16-19(4)15-11(2)7-18(3,25)8-13(15)21(27,20(16,5)26)14(10-23)17(19)24/h10-13,15-16,22-23,25-27H,6-9H2,1-5H3/b14-10+/t11-,12+,13+,15+,16-,18-,19-,20+,21+/m1/s1 |
| InChIKey | JTFGPTHCAAUOQL-RNPLJHCFSA-N |
| Roles Classification |
|---|
| Chemical Role: | |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. phytotoxin Any toxin produced by a plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stemphyloxin II (CHEBI:145066) has functional parent betaenone A (CHEBI:145055) |
| stemphyloxin II (CHEBI:145066) has role fungal metabolite (CHEBI:76946) |
| stemphyloxin II (CHEBI:145066) has role iron chelator (CHEBI:38157) |
| stemphyloxin II (CHEBI:145066) has role phytotoxin (CHEBI:38231) |
| stemphyloxin II (CHEBI:145066) is a 3-oxo aldehyde (CHEBI:145078) |
| stemphyloxin II (CHEBI:145066) is a bridged compound (CHEBI:35990) |
| stemphyloxin II (CHEBI:145066) is a carbotricyclic compound (CHEBI:38032) |
| stemphyloxin II (CHEBI:145066) is a primary alcohol (CHEBI:15734) |
| stemphyloxin II (CHEBI:145066) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1S,2S,4R,6R,7S,8R,10Z,11S,12R)-1,4,11-trihydroxy-12-[(2R)-1-hydroxybutan-2-yl]-10-(hydroxymethylene)-4,6,8,11-tetramethyltricyclo[6.2.2.02,7]dodecan-9-one |
| Synonym | Source |
|---|---|
| (1R,3Z,4S,4aS,6R,8R,8aS,9S,10R)-4,6,9-trihydroxy-10-[(2R)-1-hydroxybutan-2-yl]-3-(hydroxymethylidene)-1,6,8,9-tetramethyloctahydro-1,4-ethanonaphthalen-2(1H)-one | IUPAC |
| UniProt Name | Source |
|---|---|
| stemphyloxin II | UniProt |
| Citations |
|---|