EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10Cl2N2O2 |
| Net Charge | 0 |
| Average Mass | 225.075 |
| Monoisotopic Mass | 224.01193 |
| SMILES | O=CN1CCN(C(=O)C(Cl)Cl)CC1 |
| InChI | InChI=1S/C7H10Cl2N2O2/c8-6(9)7(13)11-3-1-10(5-12)2-4-11/h5-6H,1-4H2 |
| InChIKey | RZVIXHNWFHNVDI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antispermatogenic agent An agent that destroy spermatozoa in the male genitalia and block spermatogenesis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(dichloroacetyl)piperazine-1-carbaldehyde (CHEBI:145049) has role antispermatogenic agent (CHEBI:145047) |
| 4-(dichloroacetyl)piperazine-1-carbaldehyde (CHEBI:145049) is a formamides (CHEBI:24079) |
| 4-(dichloroacetyl)piperazine-1-carbaldehyde (CHEBI:145049) is a organochlorine compound (CHEBI:36683) |
| 4-(dichloroacetyl)piperazine-1-carbaldehyde (CHEBI:145049) is a piperazines (CHEBI:26144) |
| 4-(dichloroacetyl)piperazine-1-carbaldehyde (CHEBI:145049) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 4-(dichloroacetyl)piperazine-1-carbaldehyde |
| Synonyms | Source |
|---|---|
| 4-(dichloroacetyl)-1-piperazinecarboxaldehyde | ChemIDplus |
| CDRI 84/35 | ChEBI |
| CDRI-84/35 | ChEBI |
| CDRI-8435 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:77368-16-2 | ChemIDplus |
| Citations |
|---|