EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H50O13 |
| Net Charge | 0 |
| Average Mass | 642.739 |
| Monoisotopic Mass | 642.32514 |
| SMILES | [H][C@]12CC[C@]34CC(=C)[C@](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)(CC[C@@]3([H])[C@]1(C)CCC[C@@]2(C)C(=O)O)C4 |
| InChI | InChI=1S/C32H50O13/c1-15-11-31-9-5-18-29(2,7-4-8-30(18,3)28(40)41)19(31)6-10-32(15,14-31)45-27-25(23(38)21(36)17(13-34)43-27)44-26-24(39)22(37)20(35)16(12-33)42-26/h16-27,33-39H,1,4-14H2,2-3H3,(H,40,41)/t16-,17-,18+,19+,20-,21-,22+,23+,24-,25-,26+,27+,29-,30-,31-,32+/m1/s1 |
| InChIKey | OMHUCGDTACNQEX-OSHKXICASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stevia rebaudiana (ncbitaxon:55670) | - | PubMed (17397883) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | sweetening agent Substance that sweeten food, beverages, medications, etc. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Applications: | sweetening agent Substance that sweeten food, beverages, medications, etc. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| steviolbioside (CHEBI:145030) has functional parent steviolmonoside (CHEBI:145029) |
| steviolbioside (CHEBI:145030) has role antitubercular agent (CHEBI:33231) |
| steviolbioside (CHEBI:145030) has role plant metabolite (CHEBI:76924) |
| steviolbioside (CHEBI:145030) has role sweetening agent (CHEBI:50505) |
| steviolbioside (CHEBI:145030) is a ent-kaurane diterpenoid (CHEBI:36760) |
| steviolbioside (CHEBI:145030) is a bridged compound (CHEBI:35990) |
| steviolbioside (CHEBI:145030) is a diterpene glycoside (CHEBI:71939) |
| steviolbioside (CHEBI:145030) is a monocarboxylic acid (CHEBI:25384) |
| steviolbioside (CHEBI:145030) is a tetracyclic diterpenoid (CHEBI:52557) |
| steviolbioside (CHEBI:145030) is a β-D-glucoside (CHEBI:22798) |
| steviolbioside (CHEBI:145030) is conjugate acid of steviolbioside(1−) (CHEBI:145009) |
| Incoming Relation(s) |
| steviolbioside(1−) (CHEBI:145009) is conjugate base of steviolbioside (CHEBI:145030) |
| IUPAC Name |
|---|
| 13α-[(2-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-5β,8α,9β,10α-kaur-16-en-18-oic acid |
| Synonym | Source |
|---|---|
| (−)-steviolbioside | HMDB |
| Manual Xrefs | Databases |
|---|---|
| CPD-14503 | MetaCyc |
| FDB015643 | FooDB |
| HMDB0036707 | HMDB |
| C00034696 | KNApSAcK |
| DB12434 | DrugBank |
| LMPR01040122 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:41093-60-1 | ChemIDplus |
| Citations |
|---|