EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | [H][C@]12CC[C@]34CC(=C)[C@](O)(CC[C@@]3([H])[C@]1(C)CCC[C@@]2(C)C(=O)O)C4 |
| InChI | InChI=1S/C20H30O3/c1-13-11-19-9-5-14-17(2,7-4-8-18(14,3)16(21)22)15(19)6-10-20(13,23)12-19/h14-15,23H,1,4-12H2,2-3H3,(H,21,22)/t14-,15-,17+,18+,19+,20-/m0/s1 |
| InChIKey | QFVOYBUQQBFCRH-VQSWZGCSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| steviol (CHEBI:145024) has role antineoplastic agent (CHEBI:35610) |
| steviol (CHEBI:145024) is a ent-kaurane diterpenoid (CHEBI:36760) |
| steviol (CHEBI:145024) is a bridged compound (CHEBI:35990) |
| steviol (CHEBI:145024) is a monocarboxylic acid (CHEBI:25384) |
| steviol (CHEBI:145024) is a tertiary allylic alcohol (CHEBI:134397) |
| steviol (CHEBI:145024) is a tetracyclic diterpenoid (CHEBI:52557) |
| steviol (CHEBI:145024) is conjugate acid of steviol(1−) (CHEBI:145011) |
| Incoming Relation(s) |
| rebaudioside (CHEBI:145023) has functional parent steviol (CHEBI:145024) |
| rubusoside (CHEBI:145021) has functional parent steviol (CHEBI:145024) |
| steviol glycoside (CHEBI:145027) has functional parent steviol (CHEBI:145024) |
| steviolmonoside (CHEBI:145029) has functional parent steviol (CHEBI:145024) |
| stevioside (CHEBI:9271) has functional parent steviol (CHEBI:145024) |
| steviol(1−) (CHEBI:145011) is conjugate base of steviol (CHEBI:145024) |
| IUPAC Name |
|---|
| 13α-hydroxy-5β,8α,9β,10α-kaur-16-en-18-oic acid |
| Synonyms | Source |
|---|---|
| (14-α)-13-hydroxykaur-16-en-18-oic acid | ChemIDplus |
| hydroxydehydrostevic acid | ChemIDplus |
| (−)-steviol | ChemIDplus |
| Citations |
|---|