EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19Cl2N3O |
| Net Charge | 0 |
| Average Mass | 364.276 |
| Monoisotopic Mass | 363.09052 |
| SMILES | CC(C)(C)C(=O)C(=Nc1ccc(Cl)cc1)NNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2N3O/c1-18(2,3)16(24)17(21-14-8-4-12(19)5-9-14)23-22-15-10-6-13(20)7-11-15/h4-11,22H,1-3H3,(H,21,23) |
| InChIKey | XONRRGIRSGNWFP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | sphingosine-1-phosphate receptor 3 antagonist Any sphingosine-1-phosphate receptor (S1PR) antagonist that acts as an antagonist towards the subtype 3 receptors (S1PR3). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TY 52156 (CHEBI:144947) has role sphingosine-1-phosphate receptor 3 antagonist (CHEBI:144997) |
| TY 52156 (CHEBI:144947) is a imidohydrazide (CHEBI:144996) |
| TY 52156 (CHEBI:144947) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| N',N''-bis(4-chlorophenyl)-3,3-dimethyl-2-oxobutanimidohydrazide |
| Synonyms | Source |
|---|---|
| N-(4-chlorophenyl)-3,3-dimethyl-2-oxobutanimidic 2-(4-chlorophenyl) hydrazide | SUBMITTER |
| TY-52156 | ChEBI |
| TY52156 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:934369-14-9 | SUBMITTER |
| Citations |
|---|