EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2O4 |
| Net Charge | 0 |
| Average Mass | 344.411 |
| Monoisotopic Mass | 344.17361 |
| SMILES | COc1ccc(C(O)CNC(C)CCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C19H24N2O4/c1-14(3-4-15-5-9-17(10-6-15)21(23)24)20-13-19(22)16-7-11-18(25-2)12-8-16/h5-12,14,19-20,22H,3-4,13H2,1-2H3 |
| InChIKey | DVUFPRMEKXKECP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Applications: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. animal growth promotant Substances that are administered to farmed animals to improve productivity by promoting weight gain, increasing muscle mass, limiting fat deposition, reducing feed consumption, and reducing waste production. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(4-methoxyphenyl)-2-{[4-(4-nitrophenyl)butan-2-yl]amino}ethanol (CHEBI:144925) has role animal growth promotant (CHEBI:82655) |
| 1-(4-methoxyphenyl)-2-{[4-(4-nitrophenyl)butan-2-yl]amino}ethanol (CHEBI:144925) has role β-adrenergic agonist (CHEBI:35522) |
| 1-(4-methoxyphenyl)-2-{[4-(4-nitrophenyl)butan-2-yl]amino}ethanol (CHEBI:144925) is a C-nitro compound (CHEBI:35716) |
| 1-(4-methoxyphenyl)-2-{[4-(4-nitrophenyl)butan-2-yl]amino}ethanol (CHEBI:144925) is a aromatic ether (CHEBI:35618) |
| 1-(4-methoxyphenyl)-2-{[4-(4-nitrophenyl)butan-2-yl]amino}ethanol (CHEBI:144925) is a phenylethanolamines (CHEBI:25990) |
| 1-(4-methoxyphenyl)-2-{[4-(4-nitrophenyl)butan-2-yl]amino}ethanol (CHEBI:144925) is a secondary alcohol (CHEBI:35681) |
| 1-(4-methoxyphenyl)-2-{[4-(4-nitrophenyl)butan-2-yl]amino}ethanol (CHEBI:144925) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 1-(4-methoxyphenyl)-2-{[4-(4-nitrophenyl)butan-2-yl]amino}ethanol |
| Synonyms | Source |
|---|---|
| 2-(4-(nitrophenyl) butan-2-ylamino)-1-(4-methoxyphenyl) ethanol | ChEBI |
| phenylethylamine A | ChEBI |
| Citations |
|---|