EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NO6S |
| Net Charge | 0 |
| Average Mass | 237.233 |
| Monoisotopic Mass | 237.03071 |
| SMILES | N[C@@H](CSC(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H11NO6S/c8-3(6(11)12)2-15-4(7(13)14)1-5(9)10/h3-4H,1-2,8H2,(H,9,10)(H,11,12)(H,13,14)/t3-,4?/m0/s1 |
| InChIKey | XPKKFTKCRVIDAG-WUCPZUCCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | heart (BTO:0000562) | MetaboLights (MTBLS1085) |
| Roles Classification |
|---|
| Chemical Roles: | Maillard reaction product Any thermal degradation product obtained as a result of a chemical reaction between an amino acid and a reducing sugar (Maillard reaction, a non-enzymatic browning procedure that usually imparts flavour to starch-based food products). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(2-succinyl)-L-cysteine (CHEBI:144907) has role human metabolite (CHEBI:77746) |
| S-(2-succinyl)-L-cysteine (CHEBI:144907) has role Maillard reaction product (CHEBI:77523) |
| S-(2-succinyl)-L-cysteine (CHEBI:144907) is a L-cysteine thioether (CHEBI:27532) |
| S-(2-succinyl)-L-cysteine (CHEBI:144907) is a tricarboxylic acid (CHEBI:27093) |
| IUPAC Name |
|---|
| 2-{[(2R)-2-amino-2-carboxyethyl]sulfanyl}butanedioic acid |
| Synonyms | Source |
|---|---|
| [[(2R)-2-amino-2-carboxyethyl]thio]succinic acid | ChEBI |
| S-(1,2-dicarboxyethyl)-L-cysteine | ChEBI |
| 2-[[(2R)-2-amino-2-carboxyethyl]thio]butanedioic acid | ChEBI |
| S-(2-succino)-L-cysteine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729068 | Reaxys |
| CAS:547764-73-8 | ChEBI |
| Citations |
|---|