EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H62N10O6 |
| Net Charge | 0 |
| Average Mass | 839.055 |
| Monoisotopic Mass | 838.48538 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@@H](NC(=O)CCc1ccccc1)CCCNC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1cnc3ccccc13)NC(=O)[C@@H](CC1CCCCC1)NC2=O |
| InChI | InChI=1S/C45H62N10O6/c46-45(47)49-24-9-18-34-40(57)48-23-10-19-35(51-39(56)22-21-29-12-3-1-4-13-29)44(61)55-25-11-20-38(55)43(60)54-36(26-30-14-5-2-6-15-30)41(58)53-37(42(59)52-34)27-31-28-50-33-17-8-7-16-32(31)33/h1,3-4,7-8,12-13,16-17,28,30,34-38,50H,2,5-6,9-11,14-15,18-27H2,(H,48,57)(H,51,56)(H,52,59)(H,53,58)(H,54,60)(H4,46,47,49)/t34-,35-,36+,37-,38-/m0/s1 |
| InChIKey | VATFHFJULBPYLM-ILOBPARPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antagonist Substance that attaches to and blocks cell receptors that normally bind naturally occurring substances. C5a receptor antagonist Any antagonist of the C5a receptor. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PMX-205 (CHEBI:144869) has role antagonist (CHEBI:48706) |
| PMX-205 (CHEBI:144869) has role anti-inflammatory agent (CHEBI:67079) |
| PMX-205 (CHEBI:144869) has role C5a receptor antagonist (CHEBI:144895) |
| PMX-205 (CHEBI:144869) is a azamacrocycle (CHEBI:52898) |
| PMX-205 (CHEBI:144869) is a homodetic cyclic peptide (CHEBI:24613) |
| IUPAC Name |
|---|
| N-[(3R,6S,9S,15S,20aS)-9-(3-carbamimidamidopropyl)-3-(cyclohexylmethyl)-6-(1H-indol-3-ylmethyl)-1,4,7,10,16-pentaoxoicosahydropyrrolo[1,2-a][1,4,7,10,13]pentaazacyclooctadecin-15-yl]-3-phenylpropanamide |
| Synonyms | Source |
|---|---|
| C5a receptor peptide antagonist | SUBMITTER |
| cyclic hexapeptide complement C5a antagonist | ChemIDplus |
| PMX 205 | ChEBI |
| hydrocinnamate-(orn-Pro-dcha-Trp-Arg) | ChemIDplus |
| PMX205 | ChemIDplus |
| (5→1)-lactam-N2-(1-oxo-3-phenylpropyl)-L-ornithyl-L-prolyl-3-cyclohexyl-D-alanyl-L-tryptophyl-L-arginine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:514814-49-4 | ChemIDplus |
| Citations |
|---|