EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5HClNO3 |
| Net Charge | -1 |
| Average Mass | 158.520 |
| Monoisotopic Mass | 157.96504 |
| SMILES | O=C1C=C([O-])C(=O)N=C1Cl |
| InChI | InChI=1S/C5H2ClNO3/c6-4-2(8)1-3(9)5(10)7-4/h1,9H/p-1 |
| InChIKey | UHSNLTHAMWTIQQ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-chloro-2,5-dioxo-2,5-dihydropyridin-3-olate (CHEBI:144867) is a enolate (CHEBI:142839) |
| 6-chloro-2,5-dioxo-2,5-dihydropyridin-3-olate (CHEBI:144867) is conjugate base of 6-chloro-3-hydroxypyridine-2,5-dione (CHEBI:144888) |
| Incoming Relation(s) |
| 6-chloro-3-hydroxypyridine-2,5-dione (CHEBI:144888) is conjugate acid of 6-chloro-2,5-dioxo-2,5-dihydropyridin-3-olate (CHEBI:144867) |
| IUPAC Name |
|---|
| 6-chloro-2,5-dioxo-2,5-dihydropyridin-3-olate |
| Synonyms | Source |
|---|---|
| 6-chloro-2,5-dioxo-2,5-dihydropyridin-3-ol(1−) | ChEBI |
| 6-chloro-3-hydroxypyridine-2,5-dione(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 6-chloro-3-hydroxypyridine-2,5-dione | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-16807 | MetaCyc |
| Citations |
|---|