EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O7 |
| Net Charge | 0 |
| Average Mass | 358.346 |
| Monoisotopic Mass | 358.10525 |
| SMILES | COc1cc(O)c2c(=O)c(OC)c(-c3ccc(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C19H18O7/c1-22-11-8-12(20)16-15(9-11)26-18(19(25-4)17(16)21)10-5-6-13(23-2)14(7-10)24-3/h5-9,20H,1-4H3 |
| InChIKey | HHGPYJLEJGNWJA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxy-3,3',4',7-tetramethoxyflavone (CHEBI:144861) has role plant metabolite (CHEBI:76924) |
| 5-hydroxy-3,3',4',7-tetramethoxyflavone (CHEBI:144861) is a 3'-methoxyflavones (CHEBI:138730) |
| 5-hydroxy-3,3',4',7-tetramethoxyflavone (CHEBI:144861) is a monohydroxyflavone (CHEBI:38687) |
| 5-hydroxy-3,3',4',7-tetramethoxyflavone (CHEBI:144861) is a tetramethoxyflavone (CHEBI:76875) |
| 5-hydroxy-3,3',4',7-tetramethoxyflavone (CHEBI:144861) is conjugate acid of 5-hydroxy-3,3',4',7-tetramethoxyflavone(1−) (CHEBI:144096) |
| Incoming Relation(s) |
| 5-hydroxy-3,3',4',7-tetramethoxyflavone(1−) (CHEBI:144096) is conjugate base of 5-hydroxy-3,3',4',7-tetramethoxyflavone (CHEBI:144861) |
| IUPAC Name |
|---|
| 2-(3,4-dimethoxyphenyl)-5-hydroxy-3,7-dimethoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5-hydroxy-3,3',4',7-tetramethoxyflavone | ChEBI |
| 3,3',4',7-O-tetramethylquercetin | ChEBI |
| 3,7,3',4'-tetramethylquercetin | SUBMITTER |
| 3,3',4',7-tetramethylquercetin | ChEBI |
| quercetin 3,3',4',7-tetramethyl ether | ChEBI |
| quercetin 3,7,3',4'-tetramethyl ether | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| CPD-14852 | MetaCyc |
| LMPK12112770 | LIPID MAPS |
| Retusin_(flavonol) | Wikipedia |
| C00004653 | KNApSAcK |
| FDB017112 | FooDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1245-15-4 | ChemIDplus |
| Citations |
|---|