EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H33NO14R |
| Net Charge | +1 |
| Average Mass (excl. R groups) | 487.454 |
| Monoisotopic Mass (excl. R groups) | 487.19010 |
| SMILES | *O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2[NH3+])[C@H]1O[C@@H]1O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/3,3,2/[a2112h-1b_1-5_1*OR][a1221m-1a_1-5][a2112h-1a_1-5_2*N]/1-2-3/a2-b1_a3-c1 |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-galactosaminyl-(1→3)-[α-L-fucosyl-(1→2)]-β-D-galactosyl derivative(1+) (CHEBI:144802) has role epitope (CHEBI:53000) |
| α-D-galactosaminyl-(1→3)-[α-L-fucosyl-(1→2)]-β-D-galactosyl derivative(1+) (CHEBI:144802) is a glycosylgalactose (CHEBI:35317) |
| UniProt Name | Source |
|---|---|
| an α-D-galactosaminyl-(1→3)-[α-L-fucosyl-(1→2)]-β-D-galactosyl derivative | UniProt |
| Citations |
|---|