EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H34N8O5 |
| Net Charge | 0 |
| Average Mass | 430.510 |
| Monoisotopic Mass | 430.26522 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C17H34N8O5/c18-8-2-1-4-11(24-14(27)10(19)6-7-13(20)26)15(28)25-12(16(29)30)5-3-9-23-17(21)22/h10-12H,1-9,18-19H2,(H2,20,26)(H,24,27)(H,25,28)(H,29,30)(H4,21,22,23)/t10-,11-,12-/m0/s1 |
| InChIKey | GURIQZQSTBBHRV-SRVKXCTJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gln-Lys-Arg (CHEBI:144723) has role metabolite (CHEBI:25212) |
| Gln-Lys-Arg (CHEBI:144723) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-glutaminyl-L-lysyl-L-arginine |
| Synonyms | Source |
|---|---|
| (Gln-Lys-Arg) | ChEBI |
| H-Gln-Lys-Arg-OH | ChEBI |
| L-Gln-L-Lys-L-Arg | ChEBI |
| QKR | ChEBI |
| Q-K-R | ChEBI |
| H-L-Gln-L-Lys-L-Arg-OH | ChEBI |