EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | C/C=C(C)\C=C\C=C(C)C |
| InChI | InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5-8H,1-4H3/b8-6+,10-5- |
| InChIKey | GQVMHMFBVWSSPF-DAIHKBMKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitis vinifera (ncbitaxon:29760) | |||
| berry (BTO:0000119) | MetaboLights (MTBLS968) | Strain: Vitis vinifera L. cv. Zaomeiguixiang | |
| berry (BTO:0000119) | MetaboLights (MTBLS968) | Strain: Vitis vinifera L. cv. Xiangfei | |
| berry (BTO:0000119) | MetaboLights (MTBLS968) | Strain: Vitis vinifera L. cv. Italia |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E,Z)-Allo-Ocimene (CHEBI:144704) is a ocimene (CHEBI:87751) |
| IUPAC Name |
|---|
| (4E,6Z)-2,6-dimethylocta-2,4,6-triene |