EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26N6O |
| Net Charge | 0 |
| Average Mass | 342.447 |
| Monoisotopic Mass | 342.21681 |
| SMILES | C[C@@H]1CCN(C(=O)N2CCCC2)C[C@@H]1N(C)c1ncnc2nccc12 |
| InChI | InChI=1S/C18H26N6O/c1-13-6-10-24(18(25)23-8-3-4-9-23)11-15(13)22(2)17-14-5-7-19-16(14)20-12-21-17/h5,7,12-13,15H,3-4,6,8-11H2,1-2H3,(H,19,20,21)/t13-,15+/m1/s1 |
| InChIKey | RONMOMUOZGIDET-HIFRSBDPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PF-956980 (CHEBI:144672) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| PF-956980 (CHEBI:144672) is a N-acylpiperidine (CHEBI:48591) |
| PF-956980 (CHEBI:144672) is a N-acylpyrrolidine (CHEBI:46766) |
| PF-956980 (CHEBI:144672) is a pyrrolopyrimidine (CHEBI:38670) |
| PF-956980 (CHEBI:144672) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| {(3R,4R)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl}(pyrrolidin-1-yl)methanone |
| Synonyms | Source |
|---|---|
| PF 956980 | ChEBI |
| PF-956980 | ChEBI |
| PF956980 | ChEBI |
| PFE-PKIS 8 | ChEBI |
| Citations |
|---|