EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N8O |
| Net Charge | 0 |
| Average Mass | 432.532 |
| Monoisotopic Mass | 432.23861 |
| SMILES | CC(C)c1cnn2c(NCc3ccccc3-n3cccn3)nc(OC3CCCNC3)nc12 |
| InChI | InChI=1S/C23H28N8O/c1-16(2)19-15-27-31-21(19)28-23(32-18-8-5-10-24-14-18)29-22(31)25-13-17-7-3-4-9-20(17)30-12-6-11-26-30/h3-4,6-7,9,11-12,15-16,18,24H,5,8,10,13-14H2,1-2H3,(H,25,28,29) |
| InChIKey | LSGRZENCFIIHNV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). antiviral agent A substance that destroys or inhibits replication of viruses. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LDC4297 (CHEBI:144671) has role antineoplastic agent (CHEBI:35610) |
| LDC4297 (CHEBI:144671) has role antiviral agent (CHEBI:22587) |
| LDC4297 (CHEBI:144671) has role apoptosis inducer (CHEBI:68495) |
| LDC4297 (CHEBI:144671) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| LDC4297 (CHEBI:144671) is a aromatic ether (CHEBI:35618) |
| LDC4297 (CHEBI:144671) is a piperidines (CHEBI:26151) |
| LDC4297 (CHEBI:144671) is a pyrazoles (CHEBI:26410) |
| LDC4297 (CHEBI:144671) is a pyrazolotriazine (CHEBI:144709) |
| LDC4297 (CHEBI:144671) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 2-(piperidin-3-yloxy)-8-(propan-2-yl)-N-[2-(1H-pyrazol-1-yl)benzyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine |
| Synonyms | Source |
|---|---|
| 2-[(piperidin-3-yl)oxy]-8-(propan-2-yl)-N-{[2-(1H-pyrazol-1-yl)phenyl]methyl}pyrazolo[1,5-a][1,3,5]triazin-4-amine | IUPAC |
| 8-(1-methylethyl)-2-(3-piperidinyloxy)-N-[[2-(1H-pyrazol-1-yl)phenyl]methyl]-pyrazolo[1,5-a]-1,3,5-triazin-4-amine | ChEBI |
| LCD044297 | ChEBI |
| LDC 4297 | ChEBI |
| LDC-4297 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1453834-21-3 | ChEBI |
| Citations |
|---|