EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:144636 - DD-2,6-diaminopimelic acid
| Formula | C7H14N2O4 |
| Net Charge | 0 |
| Average Mass | 190.199 |
| Monoisotopic Mass | 190.09536 |
| SMILES | N[C@H](CCC[C@@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m1/s1 |
| InChIKey | GMKMEZVLHJARHF-RFZPGFLSSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DD-2,6-diaminopimelic acid (CHEBI:144636) is a 2,6-diaminopimelic acid (CHEBI:23673) |
| IUPAC Name |
|---|
| (2R,6R)-2,6-diaminoheptanedioic acid |
| Synonyms | Source |
|---|---|
| (R,R)-2,6-diaminopimelic acid | ChEBI |
| DD-DAP | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:17121-19-6 | ChEBI |
| Citations |
|---|