EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10N2O2 |
| Net Charge | 0 |
| Average Mass | 118.136 |
| Monoisotopic Mass | 118.07423 |
| SMILES | NCC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C4H10N2O2/c5-2-1-3(6)4(7)8/h3H,1-2,5-6H2,(H,7,8)/t3-/m1/s1 |
| InChIKey | OGNSCSPNOLGXSM-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-2,4-diaminobutyric acid (CHEBI:144635) has functional parent butyric acid (CHEBI:30772) |
| D-2,4-diaminobutyric acid (CHEBI:144635) has role bacterial metabolite (CHEBI:76969) |
| D-2,4-diaminobutyric acid (CHEBI:144635) is a 2,4-diaminobutyric acid (CHEBI:64307) |
| D-2,4-diaminobutyric acid (CHEBI:144635) is enantiomer of L-2,4-diaminobutyric acid (CHEBI:48950) |
| Incoming Relation(s) |
| L-2,4-diaminobutyric acid (CHEBI:48950) is enantiomer of D-2,4-diaminobutyric acid (CHEBI:144635) |
| IUPAC Name |
|---|
| (2R)-2,4-diaminobutanoic acid |
| Synonyms | Source |
|---|---|
| (R)-2,4-diaminobutyric acid | ChEBI |
| (2R)-2,4-diaminobutyric acid | ChEBI |
| (R)-2,4-diaminobutanoic acid | ChEBI |
| D-DAB | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4FO | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:26908-94-1 | ChemIDplus |
| Citations |
|---|