EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H24N2O4 |
| Net Charge | +2 |
| Average Mass | 236.312 |
| Monoisotopic Mass | 236.17251 |
| SMILES | [NH3+]CCCCC[NH2+]CC(=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H22N2O4/c11-4-2-1-3-5-12-6-8(14)10(16)9(15)7-13/h9-10,12-13,15-16H,1-7,11H2/p+2/t9-,10+/m1/s1 |
| InChIKey | BZKXSLSRJJQPEX-ZJUUUORDSA-P |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(D-ribulosyl)-cadaverine(2+) (CHEBI:144612) is a cadaverine(2+) (CHEBI:58384) |
| UniProt Name | Source |
|---|---|
| N-(D-ribulosyl)-cadaverine | UniProt |
| Citations |
|---|