EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23NO6 |
| Net Charge | 0 |
| Average Mass | 361.394 |
| Monoisotopic Mass | 361.15254 |
| SMILES | [H][C@@]12C[C@@H](OC(C)=O)C[C@@H](O)[C@]13CC[N@@]2Cc1c3cc2c(c1OC)OCO2 |
| InChI | InChI=1S/C19H23NO6/c1-10(21)26-11-5-15-19(16(22)6-11)3-4-20(15)8-12-13(19)7-14-18(17(12)23-2)25-9-24-14/h7,11,15-16,22H,3-6,8-9H2,1-2H3/t11-,15-,16-,19+/m1/s1 |
| InChIKey | BSVABPABKQCTBP-GZJVQYRHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Acetylnerbowdine (CHEBI:1446) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| 3-Acetylnerbowdine | KEGG COMPOUND |