EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O3 |
| Net Charge | 0 |
| Average Mass | 102.089 |
| Monoisotopic Mass | 102.03169 |
| SMILES | [H]C(=O)C(=O)CCO |
| InChI | InChI=1S/C4H6O3/c5-2-1-4(7)3-6/h3,5H,1-2H2 |
| InChIKey | CUSSNCHZLYDUPJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO_0000131) | PubMed (25164824) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-2-oxobutanal (CHEBI:144586) has role antibacterial agent (CHEBI:33282) |
| 4-hydroxy-2-oxobutanal (CHEBI:144586) has role human xenobiotic metabolite (CHEBI:76967) |
| 4-hydroxy-2-oxobutanal (CHEBI:144586) is a 2-oxo aldehyde (CHEBI:27659) |
| 4-hydroxy-2-oxobutanal (CHEBI:144586) is a β-hydroxy ketone (CHEBI:55380) |
| IUPAC Name |
|---|
| 4-hydroxy-2-oxobutanal |
| Synonyms | Source |
|---|---|
| 4-hydroxy-2-ketobutyraldehyde | ChemIDplus |
| 4-hydroxy-2-oxobutyraldehyde | ChemIDplus |
| 4-hydroxy-1,2-butanedione | ChEBI |
| 3-deoxythreosone | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-hydroxy-2-oxobutanal | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:28119-61-1 | ChemIDplus |
| Citations |
|---|