EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O10 |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 209.176 |
| Monoisotopic Mass (excl. R groups) | 209.04500 |
| SMILES | *Oc1cc(O)c(/C=C/C(=O)O)cc1OC |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | root (BTO:0001188) | MetaboLights (MTBLS692) | Strain: No-0 [EFO:0006976] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxyferulic acid-4-O-hexoside (CHEBI:144520) is a hydroxycinnamic acid (CHEBI:24689) |