EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O2 |
| Net Charge | 0 |
| Average Mass | 168.236 |
| Monoisotopic Mass | 168.11503 |
| SMILES | [H][C@@]12CC[C@H](C)[C@]1([H])C(O)OC=C2C |
| InChI | InChI=1S/C10H16O2/c1-6-3-4-8-7(2)5-12-10(11)9(6)8/h5-6,8-11H,3-4H2,1-2H3/t6-,8-,9-,10?/m0/s1 |
| InChIKey | OJGPEAXUHQRLNC-DJOKAMFZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nepeta mussinii (ncbitaxon:54731) | - | PubMed (24263441) |
| Roles Classification |
|---|
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-cis-nepetalactol (CHEBI:144485) has role pheromone (CHEBI:26013) |
| cis-cis-nepetalactol (CHEBI:144485) has role plant metabolite (CHEBI:76924) |
| cis-cis-nepetalactol (CHEBI:144485) is a cyclopentapyran (CHEBI:38606) |
| cis-cis-nepetalactol (CHEBI:144485) is a iridoid monoterpenoid (CHEBI:50563) |
| cis-cis-nepetalactol (CHEBI:144485) is a lactol (CHEBI:38131) |
| IUPAC Name |
|---|
| (4aR,7S,7aS)-4,7-dimethyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-ol |
| Synonyms | Source |
|---|---|
| cis,cis-nepetalactol | ChEBI |
| (4aR,7S,7aS)-nepetalactol | ChEBI |
| (1RS,4aR,7S,7aS)-nepetalactol | ChEBI |
| UniProt Name | Source |
|---|---|
| cis-cis-nepetalactol | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:185399-79-5 | ChEBI |
| Citations |
|---|