EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8NO5S2 |
| Net Charge | -1 |
| Average Mass | 238.266 |
| Monoisotopic Mass | 237.98494 |
| SMILES | [NH3+][C@@H](CSSCC(=O)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H9NO5S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3H,1-2,7H2,(H,9,10)(H,11,12)/p-1/t3-/m0/s1 |
| InChIKey | BEZUIRBPGNVXFZ-VKHMYHEASA-M |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-2-ammonio-2-carboxylatoethyl-disulfanyl-oxopropanoate (CHEBI:144484) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| UniProt Name | Source |
|---|---|
| (2R)-2-amino-2-carboxylatoethyl-disulfanyl-oxopropanoate | UniProt |
| Citations |
|---|