EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O2 |
| Net Charge | 0 |
| Average Mass | 166.220 |
| Monoisotopic Mass | 166.09938 |
| SMILES | [H][C@@]12CC[C@H](C)[C@]1([H])C(=O)OC=C2C |
| InChI | InChI=1S/C10H14O2/c1-6-3-4-8-7(2)5-12-10(11)9(6)8/h5-6,8-9H,3-4H2,1-2H3/t6-,8-,9-/m0/s1 |
| InChIKey | ZDKZHVNKFOXMND-XVYDVKMFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nepeta nuda (IPNI:452615-1) | - | DOI (10.1016/S0031-9422(00)84709-3) | |
| Nepeta x faassenii (ncbitaxon:39348) | leaf (BTO:0000713) | PubMed (16900434) | |
| Nepeta persica (IPNI:452651-1) | - | PubMed (20433086) | Detected in flower, leaf, stem and root. |
| Nepeta bornmuelleri (ncbitaxon:21339) | aerial part (BTO:0001658) | DOI (10.1080/10412905.2007.9699274) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-cis-nepetalactone (CHEBI:144482) has role plant metabolite (CHEBI:76924) |
| cis-cis-nepetalactone (CHEBI:144482) is a cyclopentapyran (CHEBI:38606) |
| cis-cis-nepetalactone (CHEBI:144482) is a iridoid monoterpenoid (CHEBI:50563) |
| IUPAC Name |
|---|
| (4aR,7S,7aS)-4,7-dimethyl-5,6,7,7a-tetrahydrocyclopenta[c]pyran-1(4aH)-one |
| Synonyms | Source |
|---|---|
| (+)-cis,cis-nepetalactone | ChemIDplus |
| (4aR,7S,7aS)-nepetalactone | ChemIDplus |
| cis,cis-nepetalactone | ChemIDplus |
| 4aβ,7α,7aβ-nepetalactone | ChemIDplus |
| (+)-(4aR,7S,7aS)-nepetalactone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| cis-cis-nepetalactone | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:21651-53-6 | ChemIDplus |
| CAS:21651-53-6 | NIST Chemistry WebBook |
| Citations |
|---|