EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O2 |
| Net Charge | 0 |
| Average Mass | 168.236 |
| Monoisotopic Mass | 168.11503 |
| SMILES | C/C(C=O)=C\CC[C@H](C)/C=C/O |
| InChI | InChI=1S/C10H16O2/c1-9(6-7-11)4-3-5-10(2)8-12/h5-9,11H,3-4H2,1-2H3/b7-6+,10-5+/t9-/m0/s1 |
| InChIKey | CUVKIWGKVWHEEO-BVRNBXKUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-8-oxocitronellyl enol (CHEBI:144481) is a 8-oxocitronellyl enol (CHEBI:144930) |
| (S)-8-oxocitronellyl enol (CHEBI:144481) is enantiomer of (R)-8-oxocitronellyl enol (CHEBI:144487) |
| Incoming Relation(s) |
| (R)-8-oxocitronellyl enol (CHEBI:144487) is enantiomer of (S)-8-oxocitronellyl enol (CHEBI:144481) |
| IUPAC Name |
|---|
| (2E,6S,7E)-8-hydroxy-2,6-dimethylocta-2,7-dienal |
| UniProt Name | Source |
|---|---|
| (S)-8-oxocitronellyl enol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-22362 | MetaCyc |
| Citations |
|---|