EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O7S |
| Net Charge | 0 |
| Average Mass | 248.212 |
| Monoisotopic Mass | 247.99907 |
| SMILES | CC(=O)c1cc(OS(=O)(=O)O)c(O)cc1O |
| InChI | InChI=1S/C8H8O7S/c1-4(9)5-2-8(15-16(12,13)14)7(11)3-6(5)10/h2-3,10-11H,1H3,(H,12,13,14) |
| InChIKey | CYVRFZMFCIXKPO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (22680310) | |
| Rattus norvegicus (ncbitaxon:10116) | blood plasma (BTO_0000131) | PubMed (16787733) |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dihydroxyacetophenone-5-O-sulfate (CHEBI:144465) has role human urinary metabolite (CHEBI:84087) |
| 2,4-dihydroxyacetophenone-5-O-sulfate (CHEBI:144465) has role human xenobiotic metabolite (CHEBI:76967) |
| 2,4-dihydroxyacetophenone-5-O-sulfate (CHEBI:144465) has role rat metabolite (CHEBI:86264) |
| 2,4-dihydroxyacetophenone-5-O-sulfate (CHEBI:144465) has role xenobiotic metabolite (CHEBI:76206) |
| 2,4-dihydroxyacetophenone-5-O-sulfate (CHEBI:144465) is a acetophenones (CHEBI:22187) |
| 2,4-dihydroxyacetophenone-5-O-sulfate (CHEBI:144465) is a aryl sulfate (CHEBI:37919) |
| 2,4-dihydroxyacetophenone-5-O-sulfate (CHEBI:144465) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 5-acetyl-2,4-dihydroxyphenyl hydrogen sulfate |
| Synonym | Source |
|---|---|
| 5-acetyl-2,4-dihydroxyphenyl oxidanesulfonic acid | ChEBI |
| Citations |
|---|