EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21N3O6 |
| Net Charge | 0 |
| Average Mass | 291.304 |
| Monoisotopic Mass | 291.14304 |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H](N)CCC(CN)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H21N3O6/c1-5(15)8(11(19)20)14-9(16)7(13)3-2-6(4-12)10(17)18/h5-8,15H,2-4,12-13H2,1H3,(H,14,16)(H,17,18)(H,19,20)/t5-,6?,7+,8+/m1/s1 |
| InChIKey | MDUSHNNLINVHSC-BJLRKGDGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | liver (BTO:0000759) | MetaboLights (MTBLS586) | Strain: BALB/c [EFO:0000602] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tabtoxin biosynthesis intermediate 5; (CHEBI:144402) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (5S)-5-amino-2-(aminomethyl)-6-[[(1S,2R)-1-carboxy-2-hydroxypropyl]amino]-6-oxohexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C20915 | KEGG COMPOUND |