EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H70O13 |
| Net Charge | 0 |
| Average Mass | 819.042 |
| Monoisotopic Mass | 818.48164 |
| SMILES | [H][C@]1([C@@H](C)C[C@H](O)[C@@]2([H])O[C@]3([H])CC[C@@]4(CC[C@]([H])(/C=C/[C@@H](C)[C@]5([H])CC(C)=C[C@@]6(O[C@H](C[C@@](C)(O)C(=O)O)CC[C@H]6O)O5)O4)O[C@@]3([H])[C@H](O)C2=C)O[C@@]2(CC[C@H]1C)OCCC[C@H]2C |
| InChI | InChI=1S/C45H70O13/c1-25-21-35(56-45(23-25)36(47)13-12-32(55-45)24-42(7,51)41(49)50)26(2)10-11-31-15-17-43(54-31)18-16-34-40(57-43)37(48)30(6)39(53-34)33(46)22-28(4)38-27(3)14-19-44(58-38)29(5)9-8-20-52-44/h10-11,23,26-29,31-40,46-48,51H,6,8-9,12-22,24H2,1-5,7H3,(H,49,50)/b11-10+/t26-,27-,28+,29-,31+,32+,33+,34-,35+,36-,37-,38+,39+,40-,42-,43-,44-,45-/m1/s1 |
| InChIKey | CLBIEZBAENPDFY-HNXGFDTJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dinophysis fortii (ncbitaxon:150623) | - | Article (MED:23127709) | |
| Mus musculus (ncbitaxon:10090) | liver (BTO:0000759) | MetaboLights (MTBLS586) | Strain: BALB/c [EFO:0000602] |
| Mytilus edulis (ncbitaxon:6550) | - | DOI (10.2331/suisan.48.549) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor Any EC 3.1.3.* (phosphoric monoester hydrolase) inhibitor that interferes with the action of phosphoprotein phosphatase (EC 3.1.3.16). marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dinophysistoxin 1 (CHEBI:144400) has functional parent okadaic acid (CHEBI:44658) |
| dinophysistoxin 1 (CHEBI:144400) has role animal metabolite (CHEBI:75767) |
| dinophysistoxin 1 (CHEBI:144400) has role EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor (CHEBI:37153) |
| dinophysistoxin 1 (CHEBI:144400) has role marine metabolite (CHEBI:76507) |
| dinophysistoxin 1 (CHEBI:144400) has role toxin (CHEBI:27026) |
| dinophysistoxin 1 (CHEBI:144400) is a ketal (CHEBI:59777) |
| IUPAC Name |
|---|
| (2R)-3-[(2S,5R,6R,8S)-8-{(2R,3E)-4-[(2R,4a'R,5R,6'S,8'R,8a'S)-6'-{(1S,3S)-3-[(2S,3R,6R,11R)-3,11-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]-1-hydroxybutyl}-8'-hydroxy-7'-methylideneoctahydro-3H,3'H-spiro[furan-2,2'-pyrano[3,2-b]pyran]-5-yl]but-3-en-2-yl}-5-hydroxy-10-methyl-1,7-dioxaspiro[5.5]undec-10-en-2-yl]-2-hydroxy-2-methylpropanoic acid |
| Synonyms | Source |
|---|---|
| 35-Methylokadaic acid | ChemIDplus |
| Dinophysistoxin-1 | ChemIDplus |
| DTX 1 | KEGG COMPOUND |
| DTX-1 | ChEBI |
| DTX1 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00044717 | KNApSAcK |
| C16870 | KEGG COMPOUND |
| FDB002306 | FooDB |
| HMDB0030442 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:81720-10-7 | ChemIDplus |
| Citations |
|---|