EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O6S |
| Net Charge | 0 |
| Average Mass | 244.224 |
| Monoisotopic Mass | 244.00416 |
| SMILES | O=C(O)/C=C/c1ccc(OS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H8O6S/c10-9(11)6-3-7-1-4-8(5-2-7)15-16(12,13)14/h1-6H,(H,10,11)(H,12,13,14)/b6-3+ |
| InChIKey | OYDCCWNLILCHDJ-ZZXKWVIFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zostera marina (ncbitaxon:29655) | - | DOI (10.1016/0031-9422(93)80017-M) | Found in shoots. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antifouling biocide A compound that inhibits the growth of marine organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(sulfooxy)-cinnamic acid (CHEBI:144380) has role antifouling biocide (CHEBI:51076) |
| 4-(sulfooxy)-cinnamic acid (CHEBI:144380) has role plant metabolite (CHEBI:76924) |
| 4-(sulfooxy)-cinnamic acid (CHEBI:144380) is a aryl sulfate (CHEBI:37919) |
| 4-(sulfooxy)-cinnamic acid (CHEBI:144380) is a cinnamic acids (CHEBI:23252) |
| IUPAC Name |
|---|
| (2E)-3-[4-(sulfooxy)phenyl]prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 4-(sulfooxy)benzeneacrylic acid | ChEBI |
| p-(sulfooxy)-cinnamic acid | SUBMITTER |
| p-(sulphooxy)-cinnamic acid | ChEBI |
| zosteric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0125166 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:151481-49-1 | ChEBI |
| Citations |
|---|