EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29N2O4 |
| Net Charge | +1 |
| Average Mass | 397.495 |
| Monoisotopic Mass | 397.21218 |
| SMILES | [H][C@@]12[NH+]3CCC[C@]1(C(C)OC(C)=O)CC(C(=O)OC)=C1Nc4ccccc4[C@]12CC3 |
| InChI | InChI=1S/C23H28N2O4/c1-14(29-15(2)26)22-9-6-11-25-12-10-23(21(22)25)17-7-4-5-8-18(17)24-19(23)16(13-22)20(27)28-3/h4-5,7-8,14,21,24H,6,9-13H2,1-3H3/p+1/t14?,21-,22-,23-/m1/s1 |
| InChIKey | UELNVPGLHDEZFM-WWGYGDJHSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-echitovenine(1+) (CHEBI:144379) is a ammonium ion derivative (CHEBI:35274) |
| (+)-echitovenine(1+) (CHEBI:144379) is a indole alkaloid cation (CHEBI:60521) |
| (+)-echitovenine(1+) (CHEBI:144379) is enantiomer of (−)-echitovenine(1+) (CHEBI:144384) |
| Incoming Relation(s) |
| (−)-echitovenine(1+) (CHEBI:144384) is enantiomer of (+)-echitovenine(1+) (CHEBI:144379) |
| UniProt Name | Source |
|---|---|
| (+)-echitovenine | UniProt |
| Citations |
|---|