EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N2O4 |
| Net Charge | +1 |
| Average Mass | 369.441 |
| Monoisotopic Mass | 369.18088 |
| SMILES | [H][C@@]12[NH+]3CC[C@]14C(=C(C(=O)OC)C[C@]2([C@@H](C)O)[C@H]1O[C@H]1C3)Nc1ccccc14 |
| InChI | InChI=1S/C21H24N2O4/c1-11(24)21-9-12(18(25)26-2)16-20(13-5-3-4-6-14(13)22-16)7-8-23(19(20)21)10-15-17(21)27-15/h3-6,11,15,17,19,22,24H,7-10H2,1-2H3/p+1/t11-,15+,17+,19-,20+,21+/m1/s1 |
| InChIKey | QVNXPWJNUKKMHP-JJGNIUBRSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hörhammericine(1+) (CHEBI:144375) is a ammonium ion derivative (CHEBI:35274) |
| hörhammericine(1+) (CHEBI:144375) is a indole alkaloid cation (CHEBI:60521) |
| hörhammericine(1+) (CHEBI:144375) is conjugate acid of hörhammericine (CHEBI:5765) |
| Incoming Relation(s) |
| hörhammericine (CHEBI:5765) is conjugate base of hörhammericine(1+) (CHEBI:144375) |
| Synonym | Source |
|---|---|
| horhammericine(1+) | ChEBI |
| UniProt Name | Source |
|---|---|
| horhammericine | UniProt |
| Citations |
|---|