EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N2O3 |
| Net Charge | +1 |
| Average Mass | 353.442 |
| Monoisotopic Mass | 353.18597 |
| SMILES | [H][C@@]12[NH+]3CC[C@]14C(=C(C(=O)OC)C[C@]2(CC)[C@H]1O[C@H]1C3)Nc1ccccc14 |
| InChI | InChI=1S/C21H24N2O3/c1-3-20-10-12(18(24)25-2)16-21(13-6-4-5-7-14(13)22-16)8-9-23(19(20)21)11-15-17(20)26-15/h4-7,15,17,19,22H,3,8-11H2,1-2H3/p+1/t15-,17-,19-,20+,21-/m0/s1 |
| InChIKey | AUVZFRDLRJQTQF-KXEYLTKFSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lochnericine(1+) (CHEBI:144374) is a ammonium ion derivative (CHEBI:35274) |
| lochnericine(1+) (CHEBI:144374) is a indole alkaloid cation (CHEBI:60521) |
| lochnericine(1+) (CHEBI:144374) is conjugate acid of lochnericine (CHEBI:6510) |
| Incoming Relation(s) |
| lochnericine (CHEBI:6510) is conjugate base of lochnericine(1+) (CHEBI:144374) |
| IUPAC Name |
|---|
| 3-(methoxycarbonyl)-5α,6α,7α,12β,19α-2,3-didehydro-6,7-epoxyaspidospermidin-9-ium |
| UniProt Name | Source |
|---|---|
| lochnericine | UniProt |
| Citations |
|---|