EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N2O3 |
| Net Charge | +1 |
| Average Mass | 353.442 |
| Monoisotopic Mass | 353.18597 |
| SMILES | [H][C@]12[NH+]3CC=C[C@@]1([C@@H](C)O)CC(C(=O)OC)=C1Nc4ccccc4[C@@]12CC3 |
| InChI | InChI=1S/C21H24N2O3/c1-13(24)20-8-5-10-23-11-9-21(19(20)23)15-6-3-4-7-16(15)22-17(21)14(12-20)18(25)26-2/h3-8,13,19,22,24H,9-12H2,1-2H3/p+1/t13-,19+,20+,21+/m1/s1 |
| InChIKey | XDGRXQNYJMQLPU-VLCNGCBASA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-(R)-19-hydroxytabersonine(1+) (CHEBI:144372) is a ammonium ion derivative (CHEBI:35274) |
| (−)-(R)-19-hydroxytabersonine(1+) (CHEBI:144372) is a indole alkaloid cation (CHEBI:60521) |
| (−)-(R)-19-hydroxytabersonine(1+) (CHEBI:144372) is conjugate acid of 19-Hydroxytabersonine (CHEBI:797) |
| Incoming Relation(s) |
| 19-Hydroxytabersonine (CHEBI:797) is conjugate base of (−)-(R)-19-hydroxytabersonine(1+) (CHEBI:144372) |
| UniProt Name | Source |
|---|---|
| (−)-(R)-19-hydroxytabersonine | UniProt |
| Citations |
|---|