EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10N2O |
| Net Charge | 0 |
| Average Mass | 210.236 |
| Monoisotopic Mass | 210.07931 |
| SMILES | O=C(/C=C/c1cccnc1)c1ccncc1 |
| InChI | InChI=1S/C13H10N2O/c16-13(12-5-8-14-9-6-12)4-3-11-2-1-7-15-10-11/h1-10H/b4-3+ |
| InChIKey | UOWGYMNWMDNSTL-ONEGZZNKSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.1.105 (6-phosphofructo-2-kinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of 6-phosphofructo-2-kinase (EC 2.7.1.105). autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3PO (CHEBI:144367) has role angiogenesis inhibitor (CHEBI:48422) |
| 3PO (CHEBI:144367) has role antineoplastic agent (CHEBI:35610) |
| 3PO (CHEBI:144367) has role apoptosis inducer (CHEBI:68495) |
| 3PO (CHEBI:144367) has role autophagy inducer (CHEBI:138880) |
| 3PO (CHEBI:144367) has role EC 2.7.1.105 (6-phosphofructo-2-kinase) inhibitor (CHEBI:144387) |
| 3PO (CHEBI:144367) is a enone (CHEBI:51689) |
| 3PO (CHEBI:144367) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| (2E)-3-(pyridin-3-yl)-1-(pyridin-4-yl)prop-2-en-1-one |
| Synonyms | Source |
|---|---|
| (2E)-3-(3-pyridinyl)-1-(4-pyridinyl)-2-propen-1-one | ChEBI |
| 3-(3-pyridinyl)-1-(4-pyridinyl)-2-propen-1-one | SUBMITTER |
| 3PO | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:18550-98-6 | ChEBI |
| Citations |
|---|