EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N3O4 |
| Net Charge | 0 |
| Average Mass | 331.372 |
| Monoisotopic Mass | 331.15321 |
| SMILES | NC(=O)CC[C@H](NC(=O)CCCc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H21N3O4/c18-15(21)9-8-14(17(23)24)20-16(22)7-3-4-11-10-19-13-6-2-1-5-12(11)13/h1-2,5-6,10,14,19H,3-4,7-9H2,(H2,18,21)(H,20,22)(H,23,24)/t14-/m0/s1 |
| InChIKey | DGZSVIAYDFRXQW-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-[4-(indol-3-yl)butanoyl]-L-glutamine (CHEBI:144365) has functional parent indole-3-butyric acid (CHEBI:33070) |
| N2-[4-(indol-3-yl)butanoyl]-L-glutamine (CHEBI:144365) is a N2-acyl-L-glutamine (CHEBI:17008) |
| N2-[4-(indol-3-yl)butanoyl]-L-glutamine (CHEBI:144365) is a indoles (CHEBI:24828) |
| N2-[4-(indol-3-yl)butanoyl]-L-glutamine (CHEBI:144365) is a primary carboxamide (CHEBI:140324) |
| N2-[4-(indol-3-yl)butanoyl]-L-glutamine (CHEBI:144365) is a secondary carboxamide (CHEBI:140325) |
| N2-[4-(indol-3-yl)butanoyl]-L-glutamine (CHEBI:144365) is conjugate acid of N2-[4-(indol-3-yl)butanoyl]-L-glutaminate (CHEBI:143275) |
| Incoming Relation(s) |
| N2-[4-(indol-3-yl)butanoyl]-L-glutaminate (CHEBI:143275) is conjugate base of N2-[4-(indol-3-yl)butanoyl]-L-glutamine (CHEBI:144365) |
| IUPAC Name |
|---|
| N2-[4-(1H-indol-3-yl)butanoyl]-L-glutamine |
| Synonym | Source |
|---|---|
| (2S)-5-amino-2-[4-(1H-indol-3-yl)butanoylamino]-5-oxopentanoic acid | ChEBI |
| Citations |
|---|