EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:144356 - methyl henicosanoate
| Formula | C22H44O2 |
| Net Charge | 0 |
| Average Mass | 340.592 |
| Monoisotopic Mass | 340.33413 |
| SMILES | CCCCCCCCCCCCCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C22H44O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-2/h3-21H2,1-2H3 |
| InChIKey | AJRICDSAJQHDSD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ranunculus ternatus (ncbitaxon:376254) | root (BTO:0001188) | PubMed (20873554) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl henicosanoate (CHEBI:144356) has functional parent henicosanoic acid (CHEBI:39248) |
| methyl henicosanoate (CHEBI:144356) has role plant metabolite (CHEBI:76924) |
| methyl henicosanoate (CHEBI:144356) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| methyl henicosanoate |
| Synonyms | Source |
|---|---|
| henicosanoic acid methyl ester | ChEBI |
| methyl heneicosanoate | ChEBI |
| heneicosanoic acid methyl ester | ChEBI |
| methyl henicosaneate | ChemIDplus |
| Citations |
|---|