EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O2 |
| Net Charge | 0 |
| Average Mass | 292.463 |
| Monoisotopic Mass | 292.24023 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)OC |
| InChI | InChI=1S/C19H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h7-8,10-11,13-14H,3-6,9,12,15-18H2,1-2H3/b8-7-,11-10-,14-13- |
| InChIKey | JFRWATCOFCPIBM-JPFHKJGASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arthrospira platensis (ncbitaxon:118562) | - | PubMed (26238515) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl γ-linolenate (CHEBI:144354) has functional parent γ-linolenic acid (CHEBI:28661) |
| methyl γ-linolenate (CHEBI:144354) has role antibacterial agent (CHEBI:33282) |
| methyl γ-linolenate (CHEBI:144354) has role antineoplastic agent (CHEBI:35610) |
| methyl γ-linolenate (CHEBI:144354) has role apoptosis inducer (CHEBI:68495) |
| methyl γ-linolenate (CHEBI:144354) has role bacterial metabolite (CHEBI:76969) |
| methyl γ-linolenate (CHEBI:144354) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| methyl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
| Synonyms | Source |
|---|---|
| (6Z,9Z,12Z)-6,9,12-octadecatrienoic acid methyl ester | ChEBI |
| C18:3 (all cis-6,9,12) methyl ester | ChEBI |
| methyl GLA | ChEBI |
| methyl (Z,Z,Z)-6,9,12-octadecatrienoate | ChemIDplus |
| γ-linolenic acid methyl ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:16326-32-2 | ChemIDplus |
| Citations |
|---|